C12H24O3 — CID 3020767
(1-hydroxy-2,2-dimethylhexan-3-yl) 2-methylpropanoate (PubChem CID 3020767) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is (1-hydroxy-2,2-dimethylhexan-3-yl) 2-methylpropanoate.
| Compound Name | (1-hydroxy-2,2-dimethylhexan-3-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 3020767 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | (1-hydroxy-2,2-dimethylhexan-3-yl) 2-methylpropanoate |
| SMILES | CCCC(OC(=O)C(C)C)C(C)(C)CO |
| InChI | InChI=1S/C12H24O3/c1-6-7-10(12(4,5)8-13)15-11(14)9(2)3/h9-10,13H,6-8H2,1-5H3 |
| InChIKey | FFNFFJIEBFOUED-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |