C17H28O16 — CID 141084673
1,1,1-tris(2,3-dihydroxypropanoyloxy)pentan-2-yl 2,3-dihydroxypropanoate (PubChem CID 141084673) has the molecular formula C17H28O16 and a molecular weight of 488.40 g/mol. Its IUPAC name is 1,1,1-tris(2,3-dihydroxypropanoyloxy)pentan-2-yl 2,3-dihydroxypropanoate.
| Compound Name | 1,1,1-tris(2,3-dihydroxypropanoyloxy)pentan-2-yl 2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 141084673 |
| Molecular Formula | C17H28O16 |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 1,1,1-tris(2,3-dihydroxypropanoyloxy)pentan-2-yl 2,3-dihydroxypropanoate |
| SMILES | CCCC(OC(=O)C(O)CO)C(OC(=O)C(O)CO)(OC(=O)C(O)CO)OC(=O)C(O)CO |
| InChI | InChI=1S/C17H28O16/c1-2-3-12(30-13(26)8(22)4-18)17(31-14(27)9(23)5-19,32-15(28)10(24)6-20)33-16(29)11(25)7-21/h8-12,18-25H,2-7H2,1H3 |
| InChIKey | RCKPSYWUWBJDAV-UHFFFAOYSA-N |
| XLogP | -5.61 |
| TPSA | 267.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | -5.61 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|