C6H14O3Si — CID 173140077
2,3-dihydroxy-1-propylsilylpropan-1-one (PubChem CID 173140077) has the molecular formula C6H14O3Si and a molecular weight of 162.26 g/mol. Its IUPAC name is 2,3-dihydroxy-1-propylsilylpropan-1-one.
| Compound Name | 2,3-dihydroxy-1-propylsilylpropan-1-one |
|---|---|
| PubChem CID | 173140077 |
| Molecular Formula | C6H14O3Si |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 2,3-dihydroxy-1-propylsilylpropan-1-one |
| SMILES | CCC[SiH2]C(=O)C(O)CO |
| InChI | InChI=1S/C6H14O3Si/c1-2-3-10-6(9)5(8)4-7/h5,7-8H,2-4,10H2,1H3 |
| InChIKey | GFQKLRAPDZONEY-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|