C24H38O24 — CID 141490884
1,1,1,2,2-pentakis(2,3-dihydroxypropanoyloxy)hexan-3-yl 2,3-dihydroxypropanoate (PubChem CID 141490884) has the molecular formula C24H38O24 and a molecular weight of 710.54 g/mol. Its IUPAC name is 1,1,1,2,2-pentakis(2,3-dihydroxypropanoyloxy)hexan-3-yl 2,3-dihydroxypropanoate.
| Compound Name | 1,1,1,2,2-pentakis(2,3-dihydroxypropanoyloxy)hexan-3-yl 2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 141490884 |
| Molecular Formula | C24H38O24 |
| Molecular Weight | 710.54 g/mol |
| Exact Mass | 710.18 |
| IUPAC Name | 1,1,1,2,2-pentakis(2,3-dihydroxypropanoyloxy)hexan-3-yl 2,3-dihydroxypropanoate |
| SMILES | CCCC(OC(=O)C(O)CO)C(OC(=O)C(O)CO)(OC(=O)C(O)CO)C(OC(=O)C(O)CO)(OC(=O)C(O)CO)OC(=O)C(O)CO |
| InChI | InChI=1S/C24H38O24/c1-2-3-16(43-17(37)10(31)4-25)23(44-18(38)11(32)5-26,45-19(39)12(33)6-27)24(46-20(40)13(34)7-28,47-21(41)14(35)8-29)48-22(42)15(36)9-30/h10-16,25-36H,2-9H2,1H3 |
| InChIKey | WOPZFEOZRCILBR-UHFFFAOYSA-N |
| XLogP | -9.12 |
| TPSA | 400.56 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.54 |
| LogP ≤ 5 | -9.12 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|