C12H24O2 — CID 89041122
4,4-dimethylhexan-2-yl 2-methylpropanoate (PubChem CID 89041122) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is 4,4-dimethylhexan-2-yl 2-methylpropanoate.
| Compound Name | 4,4-dimethylhexan-2-yl 2-methylpropanoate |
|---|---|
| PubChem CID | 89041122 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 4,4-dimethylhexan-2-yl 2-methylpropanoate |
| SMILES | CCC(C)(C)CC(C)OC(=O)C(C)C |
| InChI | InChI=1S/C12H24O2/c1-7-12(5,6)8-10(4)14-11(13)9(2)3/h9-10H,7-8H2,1-6H3 |
| InChIKey | UAYJVESROQLUQF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |