C15H30O2 — CID 89367103
propan-2-yl 2-tert-butyl-4,4-dimethylhexanoate (PubChem CID 89367103) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is propan-2-yl 2-tert-butyl-4,4-dimethylhexanoate.
| Compound Name | propan-2-yl 2-tert-butyl-4,4-dimethylhexanoate |
|---|---|
| PubChem CID | 89367103 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | propan-2-yl 2-tert-butyl-4,4-dimethylhexanoate |
| SMILES | CCC(C)(C)CC(C(=O)OC(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H30O2/c1-9-15(7,8)10-12(14(4,5)6)13(16)17-11(2)3/h11-12H,9-10H2,1-8H3 |
| InChIKey | BYQPBGFZVGFSGG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |