C12H27N — CID 89354237
2-[(2R)-butan-2-yl]-4,4-dimethylhexan-1-amine (PubChem CID 89354237) has the molecular formula C12H27N and a molecular weight of 185.35 g/mol. Its IUPAC name is 2-[(2R)-butan-2-yl]-4,4-dimethylhexan-1-amine.
| Compound Name | 2-[(2R)-butan-2-yl]-4,4-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 89354237 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | 2-[(2R)-butan-2-yl]-4,4-dimethylhexan-1-amine |
| SMILES | CC[C@@H](C)C(CN)CC(C)(C)CC |
| InChI | InChI=1S/C12H27N/c1-6-10(3)11(9-13)8-12(4,5)7-2/h10-11H,6-9,13H2,1-5H3/t10-,11?/m1/s1 |
| InChIKey | ANORUKWBKNTGKR-NFJWQWPMSA-N |
| XLogP | 3.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |