C14H32Si — CID 91235940
trimethyl(2,2,5,5-tetramethylheptan-3-yl)silane (PubChem CID 91235940) has the molecular formula C14H32Si and a molecular weight of 228.50 g/mol. Its IUPAC name is trimethyl(2,2,5,5-tetramethylheptan-3-yl)silane.
| Compound Name | trimethyl(2,2,5,5-tetramethylheptan-3-yl)silane |
|---|---|
| PubChem CID | 91235940 |
| Molecular Formula | C14H32Si |
| Molecular Weight | 228.50 g/mol |
| Exact Mass | 228.23 |
| IUPAC Name | trimethyl(2,2,5,5-tetramethylheptan-3-yl)silane |
| SMILES | CCC(C)(C)CC(C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H32Si/c1-10-14(5,6)11-12(13(2,3)4)15(7,8)9/h12H,10-11H2,1-9H3 |
| InChIKey | HMQNVSCNCFIPJI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.50 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|