C16H36Si — CID 91295777
tert-butyl-dimethyl-(2,2,5,5-tetramethylhexan-3-yl)silane (PubChem CID 91295777) has the molecular formula C16H36Si and a molecular weight of 256.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2,2,5,5-tetramethylhexan-3-yl)silane.
| Compound Name | tert-butyl-dimethyl-(2,2,5,5-tetramethylhexan-3-yl)silane |
|---|---|
| PubChem CID | 91295777 |
| Molecular Formula | C16H36Si |
| Molecular Weight | 256.55 g/mol |
| Exact Mass | 256.26 |
| IUPAC Name | tert-butyl-dimethyl-(2,2,5,5-tetramethylhexan-3-yl)silane |
| SMILES | CC(C)(C)CC(C(C)(C)C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H36Si/c1-14(2,3)12-13(15(4,5)6)17(10,11)16(7,8)9/h13H,12H2,1-11H3 |
| InChIKey | YBSZLYGLSGIXEY-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.55 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|