C13H29NO — CID 129042330
4,4-dimethyl-2-(2-methylbutan-2-yloxy)hexan-1-amine (PubChem CID 129042330) has the molecular formula C13H29NO and a molecular weight of 215.38 g/mol. Its IUPAC name is 4,4-dimethyl-2-(2-methylbutan-2-yloxy)hexan-1-amine.
| Compound Name | 4,4-dimethyl-2-(2-methylbutan-2-yloxy)hexan-1-amine |
|---|---|
| PubChem CID | 129042330 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | 4,4-dimethyl-2-(2-methylbutan-2-yloxy)hexan-1-amine |
| SMILES | CCC(C)(C)CC(CN)OC(C)(C)CC |
| InChI | InChI=1S/C13H29NO/c1-7-12(3,4)9-11(10-14)15-13(5,6)8-2/h11H,7-10,14H2,1-6H3 |
| InChIKey | IXGWUOMXVJISDT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |