C20H42O2 — CID 171725381
4,7-bis(2-methylbutan-2-yloxy)decane (PubChem CID 171725381) has the molecular formula C20H42O2 and a molecular weight of 314.55 g/mol. Its IUPAC name is 4,7-bis(2-methylbutan-2-yloxy)decane.
| Compound Name | 4,7-bis(2-methylbutan-2-yloxy)decane |
|---|---|
| PubChem CID | 171725381 |
| Molecular Formula | C20H42O2 |
| Molecular Weight | 314.55 g/mol |
| Exact Mass | 314.32 |
| IUPAC Name | 4,7-bis(2-methylbutan-2-yloxy)decane |
| SMILES | CCCC(CCC(CCC)OC(C)(C)CC)OC(C)(C)CC |
| InChI | InChI=1S/C20H42O2/c1-9-13-17(21-19(5,6)11-3)15-16-18(14-10-2)22-20(7,8)12-4/h17-18H,9-16H2,1-8H3 |
| InChIKey | MITYWOMPXYRVNU-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.55 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |