C23H37F5O4 — CID 87167120
[1-[2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethyl]cyclohexyl] 2-tert-butyl-4,4-dimethylhexanoate (PubChem CID 87167120) has the molecular formula C23H37F5O4 and a molecular weight of 472.54 g/mol. Its IUPAC name is [1-[2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethyl]cyclohexyl] 2-tert-butyl-4,4-dimethylhexanoate.
| Compound Name | [1-[2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethyl]cyclohexyl] 2-tert-butyl-4,4-dimethylhexanoate |
|---|---|
| PubChem CID | 87167120 |
| Molecular Formula | C23H37F5O4 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | [1-[2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethyl]cyclohexyl] 2-tert-butyl-4,4-dimethylhexanoate |
| SMILES | CCC(C)(C)CC(C(=O)OC1(CC(=O)OCC(F)(F)C(F)(F)F)CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C23H37F5O4/c1-7-20(5,6)13-16(19(2,3)4)18(30)32-21(11-9-8-10-12-21)14-17(29)31-15-22(24,25)23(26,27)28/h16H,7-15H2,1-6H3 |
| InChIKey | LFSYRDORWPWDNJ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|