C20H33F5O4 — CID 89030592
[2-methyl-4-oxo-4-(2,2,3,3,3-pentafluoropropoxy)butan-2-yl] 2,4,4-trimethyl-2-propan-2-ylhexanoate (PubChem CID 89030592) has the molecular formula C20H33F5O4 and a molecular weight of 432.47 g/mol. Its IUPAC name is [2-methyl-4-oxo-4-(2,2,3,3,3-pentafluoropropoxy)butan-2-yl] 2,4,4-trimethyl-2-propan-2-ylhexanoate.
| Compound Name | [2-methyl-4-oxo-4-(2,2,3,3,3-pentafluoropropoxy)butan-2-yl] 2,4,4-trimethyl-2-propan-2-ylhexanoate |
|---|---|
| PubChem CID | 89030592 |
| Molecular Formula | C20H33F5O4 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | [2-methyl-4-oxo-4-(2,2,3,3,3-pentafluoropropoxy)butan-2-yl] 2,4,4-trimethyl-2-propan-2-ylhexanoate |
| SMILES | CCC(C)(C)CC(C)(C(=O)OC(C)(C)CC(=O)OCC(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C20H33F5O4/c1-9-16(4,5)11-18(8,13(2)3)15(27)29-17(6,7)10-14(26)28-12-19(21,22)20(23,24)25/h13H,9-12H2,1-8H3 |
| InChIKey | MMOUTDNJRXGOSF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|