C21H33F5O6 — CID 88895102
1-O-(2,2,3,3,3-pentafluoropropyl) 3-O-[[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxymethyl] propanedioate (PubChem CID 88895102) has the molecular formula C21H33F5O6 and a molecular weight of 476.48 g/mol. Its IUPAC name is 1-O-(2,2,3,3,3-pentafluoropropyl) 3-O-[[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxymethyl] propanedioate.
| Compound Name | 1-O-(2,2,3,3,3-pentafluoropropyl) 3-O-[[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxymethyl] propanedioate |
|---|---|
| PubChem CID | 88895102 |
| Molecular Formula | C21H33F5O6 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 1-O-(2,2,3,3,3-pentafluoropropyl) 3-O-[[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxymethyl] propanedioate |
| SMILES | CCC(C)(C)CC(C)(C(=O)OCOC(=O)CC(=O)OCC(F)(F)C(F)(F)F)C(C)(C)CC |
| InChI | InChI=1S/C21H33F5O6/c1-8-17(3,4)11-19(7,18(5,6)9-2)16(29)32-13-31-15(28)10-14(27)30-12-20(22,23)21(24,25)26/h8-13H2,1-7H3 |
| InChIKey | QEUYFYJUDKGBRS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|