C18H32F4O6S — CID 155203543
1,1,2,2-tetrafluoro-2-[2-[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxyethoxy]ethanesulfonic acid (PubChem CID 155203543) has the molecular formula C18H32F4O6S and a molecular weight of 452.51 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[2-[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxyethoxy]ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[2-[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxyethoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 155203543 |
| Molecular Formula | C18H32F4O6S |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[2-[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxyethoxy]ethanesulfonic acid |
| SMILES | CCC(C)(C)CC(C)(C(=O)OCCOC(F)(F)C(F)(F)S(=O)(=O)O)C(C)(C)CC |
| InChI | InChI=1S/C18H32F4O6S/c1-8-14(3,4)12-16(7,15(5,6)9-2)13(23)27-10-11-28-17(19,20)18(21,22)29(24,25)26/h8-12H2,1-7H3,(H,24,25,26) |
| InChIKey | IDIATXDPONWVFX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|