C17H34O5S — CID 167636038
7-(2-ethyl-2-methylbutanoyl)oxy-2,5,5-trimethylheptane-2-sulfonic acid (PubChem CID 167636038) has the molecular formula C17H34O5S and a molecular weight of 350.52 g/mol. Its IUPAC name is 7-(2-ethyl-2-methylbutanoyl)oxy-2,5,5-trimethylheptane-2-sulfonic acid.
| Compound Name | 7-(2-ethyl-2-methylbutanoyl)oxy-2,5,5-trimethylheptane-2-sulfonic acid |
|---|---|
| PubChem CID | 167636038 |
| Molecular Formula | C17H34O5S |
| Molecular Weight | 350.52 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 7-(2-ethyl-2-methylbutanoyl)oxy-2,5,5-trimethylheptane-2-sulfonic acid |
| SMILES | CCC(C)(CC)C(=O)OCCC(C)(C)CCC(C)(C)S(=O)(=O)O |
| InChI | InChI=1S/C17H34O5S/c1-8-17(7,9-2)14(18)22-13-12-15(3,4)10-11-16(5,6)23(19,20)21/h8-13H2,1-7H3,(H,19,20,21) |
| InChIKey | OMHLDAZZYMBAEN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|