C12H28O8S2 — CID 21303567
2-methyl-4-[2-[3-methyl-3-(trihydroxy-λ4-sulfanyl)butoxy]ethoxy]butane-2-sulfonic acid (PubChem CID 21303567) has the molecular formula C12H28O8S2 and a molecular weight of 364.48 g/mol. Its IUPAC name is 2-methyl-4-[2-[3-methyl-3-(trihydroxy-λ4-sulfanyl)butoxy]ethoxy]butane-2-sulfonic acid.
| Compound Name | 2-methyl-4-[2-[3-methyl-3-(trihydroxy-λ4-sulfanyl)butoxy]ethoxy]butane-2-sulfonic acid |
|---|---|
| PubChem CID | 21303567 |
| Molecular Formula | C12H28O8S2 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-methyl-4-[2-[3-methyl-3-(trihydroxy-λ4-sulfanyl)butoxy]ethoxy]butane-2-sulfonic acid |
| SMILES | CC(C)(CCOCCOCCC(C)(C)S(=O)(=O)O)S(O)(O)O |
| InChI | InChI=1S/C12H28O8S2/c1-11(2,21(13,14)15)5-7-19-9-10-20-8-6-12(3,4)22(16,17)18/h13-15H,5-10H2,1-4H3,(H,16,17,18) |
| InChIKey | JWLSYTBKMAJYEK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|