4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid

C14H28O5 — CID 104565005

IUPAC4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid
SMILESCCCCOCCOCCOCCC(C)(C)C(=O)O
InChIInChI=1S/C14H28O5/c1-4-5-7-17-9-11-19-12-10-18-8-6-14(2,3)13(15)16/h4-12H2,1-3H3,(H,15,16)
InChIKeyVMJPJYUYPPBFJC-UHFFFAOYSA-N
MW276.37 g/mol
LogP2.34
Rot. Bonds13

About 4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid

4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid (PubChem CID 104565005) has the molecular formula C14H28O5 and a molecular weight of 276.37 g/mol. Its IUPAC name is 4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid.

Molecular Properties

Compound Name4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid
PubChem CID104565005
Molecular FormulaC14H28O5
Molecular Weight276.37 g/mol
Exact Mass276.19
IUPAC Name4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid
SMILESCCCCOCCOCCOCCC(C)(C)C(=O)O
InChIInChI=1S/C14H28O5/c1-4-5-7-17-9-11-19-12-10-18-8-6-14(2,3)13(15)16/h4-12H2,1-3H3,(H,15,16)
InChIKeyVMJPJYUYPPBFJC-UHFFFAOYSA-N
XLogP2.34
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds13
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.37
LogP ≤ 52.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid?
The IUPAC name of 4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid (CID 104565005) is 4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid.
What is the SMILES notation for 4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid?
The canonical SMILES for 4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid is CCCCOCCOCCOCCC(C)(C)C(=O)O.
What is the InChIKey of 4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid?
The InChIKey is VMJPJYUYPPBFJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O5/c1-4-5-7-17-9-11-19-12-10-18-8-6-14(2,3)13(15)16/h4-12H2,1-3H3,(H,15,16).
What are the key properties of 4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid?
4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid has a molecular weight of 276.37 g/mol, XLogP of 2.34, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid is sourced from PubChem (CID 104565005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).