C14H28O5 — CID 104565005
4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid (PubChem CID 104565005) has the molecular formula C14H28O5 and a molecular weight of 276.37 g/mol. Its IUPAC name is 4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 104565005 |
| Molecular Formula | C14H28O5 |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 4-[2-(2-butoxyethoxy)ethoxy]-2,2-dimethylbutanoic acid |
| SMILES | CCCCOCCOCCOCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C14H28O5/c1-4-5-7-17-9-11-19-12-10-18-8-6-14(2,3)13(15)16/h4-12H2,1-3H3,(H,15,16) |
| InChIKey | VMJPJYUYPPBFJC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|