3-hexoxy-2,2-dimethylpropanoic acid

C11H22O3 — CID 79622011

IUPAC3-hexoxy-2,2-dimethylpropanoic acid
SMILESCCCCCCOCC(C)(C)C(=O)O
InChIInChI=1S/C11H22O3/c1-4-5-6-7-8-14-9-11(2,3)10(12)13/h4-9H2,1-3H3,(H,12,13)
InChIKeyAETHUAHUUBXUHD-UHFFFAOYSA-N
MW202.29 g/mol
LogP2.69
Rot. Bonds8

About 3-hexoxy-2,2-dimethylpropanoic acid

3-hexoxy-2,2-dimethylpropanoic acid (PubChem CID 79622011) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is 3-hexoxy-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-hexoxy-2,2-dimethylpropanoic acid
PubChem CID79622011
Molecular FormulaC11H22O3
Molecular Weight202.29 g/mol
Exact Mass202.16
IUPAC Name3-hexoxy-2,2-dimethylpropanoic acid
SMILESCCCCCCOCC(C)(C)C(=O)O
InChIInChI=1S/C11H22O3/c1-4-5-6-7-8-14-9-11(2,3)10(12)13/h4-9H2,1-3H3,(H,12,13)
InChIKeyAETHUAHUUBXUHD-UHFFFAOYSA-N
XLogP2.69
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.29
LogP ≤ 52.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-hexoxy-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hexoxy-2,2-dimethylpropanoic acid?
The IUPAC name of 3-hexoxy-2,2-dimethylpropanoic acid (CID 79622011) is 3-hexoxy-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-hexoxy-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-hexoxy-2,2-dimethylpropanoic acid is CCCCCCOCC(C)(C)C(=O)O.
What is the InChIKey of 3-hexoxy-2,2-dimethylpropanoic acid?
The InChIKey is AETHUAHUUBXUHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3/c1-4-5-6-7-8-14-9-11(2,3)10(12)13/h4-9H2,1-3H3,(H,12,13).
What are the key properties of 3-hexoxy-2,2-dimethylpropanoic acid?
3-hexoxy-2,2-dimethylpropanoic acid has a molecular weight of 202.29 g/mol, XLogP of 2.69, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexoxy-2,2-dimethylpropanoic acid is sourced from PubChem (CID 79622011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).