C34H70O10 — CID 157473133
1,6-bis(2-butoxyethoxy)-3,4-bis[2-(2-butoxyethoxy)ethyl]hexane-3,4-diol (PubChem CID 157473133) has the molecular formula C34H70O10 and a molecular weight of 638.92 g/mol. Its IUPAC name is 1,6-bis(2-butoxyethoxy)-3,4-bis[2-(2-butoxyethoxy)ethyl]hexane-3,4-diol.
| Compound Name | 1,6-bis(2-butoxyethoxy)-3,4-bis[2-(2-butoxyethoxy)ethyl]hexane-3,4-diol |
|---|---|
| PubChem CID | 157473133 |
| Molecular Formula | C34H70O10 |
| Molecular Weight | 638.92 g/mol |
| Exact Mass | 638.50 |
| IUPAC Name | 1,6-bis(2-butoxyethoxy)-3,4-bis[2-(2-butoxyethoxy)ethyl]hexane-3,4-diol |
| SMILES | CCCCOCCOCCC(O)(CCOCCOCCCC)C(O)(CCOCCOCCCC)CCOCCOCCCC |
| InChI | InChI=1S/C34H70O10/c1-5-9-17-37-25-29-41-21-13-33(35,14-22-42-30-26-38-18-10-6-2)34(36,15-23-43-31-27-39-19-11-7-3)16-24-44-32-28-40-20-12-8-4/h35-36H,5-32H2,1-4H3 |
| InChIKey | MJDKIGJABWXVCB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.92 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|