C14H28O4 — CID 106714396
2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]hexanoic acid (PubChem CID 106714396) has the molecular formula C14H28O4 and a molecular weight of 260.37 g/mol. Its IUPAC name is 2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]hexanoic acid.
| Compound Name | 2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]hexanoic acid |
|---|---|
| PubChem CID | 106714396 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]hexanoic acid |
| SMILES | CC(C)(C)OCCOCCCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C14H28O4/c1-13(2,3)18-11-10-17-9-7-6-8-14(4,5)12(15)16/h6-11H2,1-5H3,(H,15,16) |
| InChIKey | UNIGBNFSUAAYBL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|