C14H30N2O2 — CID 106712482
2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]hexanimidamide (PubChem CID 106712482) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]hexanimidamide.
| Compound Name | 2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]hexanimidamide |
|---|---|
| PubChem CID | 106712482 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]hexanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCCOCCOC(C)(C)C |
| InChI | InChI=1S/C14H30N2O2/c1-13(2,3)18-11-10-17-9-7-6-8-14(4,5)12(15)16/h6-11H2,1-5H3,(H3,15,16) |
| InChIKey | KGPBAWFXDWXSSV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|