About 6-(3,4-dimethylcyclohexyl)oxy-2,2-dimethylhexanimidamide
6-(3,4-dimethylcyclohexyl)oxy-2,2-dimethylhexanimidamide (PubChem CID 106712451) has the molecular formula C16H32N2O
and a molecular weight of 268.44 g/mol. Its IUPAC name is 6-(3,4-dimethylcyclohexyl)oxy-2,2-dimethylhexanimidamide.
Molecular Properties
| Compound Name | 6-(3,4-dimethylcyclohexyl)oxy-2,2-dimethylhexanimidamide |
| PubChem CID | 106712451 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | 6-(3,4-dimethylcyclohexyl)oxy-2,2-dimethylhexanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCCOC1CCC(C)C(C)C1 |
| InChI | InChI=1S/C16H32N2O/c1-12-7-8-14(11-13(12)2)19-10-6-5-9-16(3,4)15(17)18/h12-14H,5-11H2,1-4H3,(H3,17,18) |
| InChIKey | AUQWAEASRLCXMG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 6-(3,4-dimethylcyclohexyl)oxy-2,2-dimethylhexanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-dimethylcyclohexyl)oxy-2,2-dimethylhexanimidamide?
The IUPAC name of 6-(3,4-dimethylcyclohexyl)oxy-2,2-dimethylhexanimidamide (CID 106712451) is 6-(3,4-dimethylcyclohexyl)oxy-2,2-dimethylhexanimidamide.
What is the SMILES notation for 6-(3,4-dimethylcyclohexyl)oxy-2,2-dimethylhexanimidamide?
The canonical SMILES for 6-(3,4-dimethylcyclohexyl)oxy-2,2-dimethylhexanimidamide is [H]/N=C(\N)C(C)(C)CCCCOC1CCC(C)C(C)C1.
What is the InChIKey of 6-(3,4-dimethylcyclohexyl)oxy-2,2-dimethylhexanimidamide?
The InChIKey is AUQWAEASRLCXMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O/c1-12-7-8-14(11-13(12)2)19-10-6-5-9-16(3,4)15(17)18/h12-14H,5-11H2,1-4H3,(H3,17,18).
What are the key properties of 6-(3,4-dimethylcyclohexyl)oxy-2,2-dimethylhexanimidamide?
6-(3,4-dimethylcyclohexyl)oxy-2,2-dimethylhexanimidamide has a molecular weight of 268.44 g/mol, XLogP of 3.96, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dimethylcyclohexyl)oxy-2,2-dimethylhexanimidamide is sourced from PubChem (CID 106712451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).