C14H26O3 — CID 64747074
6-(3,4-dimethylcyclohexyl)oxyhexanoic acid (PubChem CID 64747074) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is 6-(3,4-dimethylcyclohexyl)oxyhexanoic acid.
| Compound Name | 6-(3,4-dimethylcyclohexyl)oxyhexanoic acid |
|---|---|
| PubChem CID | 64747074 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 6-(3,4-dimethylcyclohexyl)oxyhexanoic acid |
| SMILES | CC1CCC(OCCCCCC(=O)O)CC1C |
| InChI | InChI=1S/C14H26O3/c1-11-7-8-13(10-12(11)2)17-9-5-3-4-6-14(15)16/h11-13H,3-10H2,1-2H3,(H,15,16) |
| InChIKey | RDYQMHZWQSYQCT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|