C16H31NO3 — CID 64746965
methyl 5-(3,4-dimethylcyclohexyl)oxy-2-methyl-2-(methylamino)pentanoate (PubChem CID 64746965) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is methyl 5-(3,4-dimethylcyclohexyl)oxy-2-methyl-2-(methylamino)pentanoate.
| Compound Name | methyl 5-(3,4-dimethylcyclohexyl)oxy-2-methyl-2-(methylamino)pentanoate |
|---|---|
| PubChem CID | 64746965 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | methyl 5-(3,4-dimethylcyclohexyl)oxy-2-methyl-2-(methylamino)pentanoate |
| SMILES | CNC(C)(CCCOC1CCC(C)C(C)C1)C(=O)OC |
| InChI | InChI=1S/C16H31NO3/c1-12-7-8-14(11-13(12)2)20-10-6-9-16(3,17-4)15(18)19-5/h12-14,17H,6-11H2,1-5H3 |
| InChIKey | XNWICBPGQFJQEK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|