About 6-(3,4-dimethylcyclohexyl)oxy-2-(ethylamino)-2-methylhexanamide
6-(3,4-dimethylcyclohexyl)oxy-2-(ethylamino)-2-methylhexanamide (PubChem CID 64746944) has the molecular formula C17H34N2O2
and a molecular weight of 298.47 g/mol. Its IUPAC name is 6-(3,4-dimethylcyclohexyl)oxy-2-(ethylamino)-2-methylhexanamide.
Molecular Properties
| Compound Name | 6-(3,4-dimethylcyclohexyl)oxy-2-(ethylamino)-2-methylhexanamide |
| PubChem CID | 64746944 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | 6-(3,4-dimethylcyclohexyl)oxy-2-(ethylamino)-2-methylhexanamide |
| SMILES | CCNC(C)(CCCCOC1CCC(C)C(C)C1)C(N)=O |
| InChI | InChI=1S/C17H34N2O2/c1-5-19-17(4,16(18)20)10-6-7-11-21-15-9-8-13(2)14(3)12-15/h13-15,19H,5-12H2,1-4H3,(H2,18,20) |
| InChIKey | AEMNXVLLRGOWRC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(3,4-dimethylcyclohexyl)oxy-2-(ethylamino)-2-methylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-dimethylcyclohexyl)oxy-2-(ethylamino)-2-methylhexanamide?
The IUPAC name of 6-(3,4-dimethylcyclohexyl)oxy-2-(ethylamino)-2-methylhexanamide (CID 64746944) is 6-(3,4-dimethylcyclohexyl)oxy-2-(ethylamino)-2-methylhexanamide.
What is the SMILES notation for 6-(3,4-dimethylcyclohexyl)oxy-2-(ethylamino)-2-methylhexanamide?
The canonical SMILES for 6-(3,4-dimethylcyclohexyl)oxy-2-(ethylamino)-2-methylhexanamide is CCNC(C)(CCCCOC1CCC(C)C(C)C1)C(N)=O.
What is the InChIKey of 6-(3,4-dimethylcyclohexyl)oxy-2-(ethylamino)-2-methylhexanamide?
The InChIKey is AEMNXVLLRGOWRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N2O2/c1-5-19-17(4,16(18)20)10-6-7-11-21-15-9-8-13(2)14(3)12-15/h13-15,19H,5-12H2,1-4H3,(H2,18,20).
What are the key properties of 6-(3,4-dimethylcyclohexyl)oxy-2-(ethylamino)-2-methylhexanamide?
6-(3,4-dimethylcyclohexyl)oxy-2-(ethylamino)-2-methylhexanamide has a molecular weight of 298.47 g/mol, XLogP of 2.85, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dimethylcyclohexyl)oxy-2-(ethylamino)-2-methylhexanamide is sourced from PubChem (CID 64746944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).