C14H30N2O2 — CID 103284877
2-(ethylamino)-2-methyl-5-(2-methylpentoxy)pentanamide (PubChem CID 103284877) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 2-(ethylamino)-2-methyl-5-(2-methylpentoxy)pentanamide.
| Compound Name | 2-(ethylamino)-2-methyl-5-(2-methylpentoxy)pentanamide |
|---|---|
| PubChem CID | 103284877 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 2-(ethylamino)-2-methyl-5-(2-methylpentoxy)pentanamide |
| SMILES | CCCC(C)COCCCC(C)(NCC)C(N)=O |
| InChI | InChI=1S/C14H30N2O2/c1-5-8-12(3)11-18-10-7-9-14(4,13(15)17)16-6-2/h12,16H,5-11H2,1-4H3,(H2,15,17) |
| InChIKey | BGAKNMWUSCLIMR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|