C16H33NO3 — CID 103284924
ethyl 2-methyl-4-(2-methylpentoxy)-2-(propan-2-ylamino)butanoate (PubChem CID 103284924) has the molecular formula C16H33NO3 and a molecular weight of 287.44 g/mol. Its IUPAC name is ethyl 2-methyl-4-(2-methylpentoxy)-2-(propan-2-ylamino)butanoate.
| Compound Name | ethyl 2-methyl-4-(2-methylpentoxy)-2-(propan-2-ylamino)butanoate |
|---|---|
| PubChem CID | 103284924 |
| Molecular Formula | C16H33NO3 |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.25 |
| IUPAC Name | ethyl 2-methyl-4-(2-methylpentoxy)-2-(propan-2-ylamino)butanoate |
| SMILES | CCCC(C)COCCC(C)(NC(C)C)C(=O)OCC |
| InChI | InChI=1S/C16H33NO3/c1-7-9-14(5)12-19-11-10-16(6,17-13(3)4)15(18)20-8-2/h13-14,17H,7-12H2,1-6H3 |
| InChIKey | MWHSGZCWRAXYMJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|