C17H33NO3 — CID 66323112
ethyl 5-(cyclopentylmethoxy)-2-methyl-2-(propan-2-ylamino)pentanoate (PubChem CID 66323112) has the molecular formula C17H33NO3 and a molecular weight of 299.45 g/mol. Its IUPAC name is ethyl 5-(cyclopentylmethoxy)-2-methyl-2-(propan-2-ylamino)pentanoate.
| Compound Name | ethyl 5-(cyclopentylmethoxy)-2-methyl-2-(propan-2-ylamino)pentanoate |
|---|---|
| PubChem CID | 66323112 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.45 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | ethyl 5-(cyclopentylmethoxy)-2-methyl-2-(propan-2-ylamino)pentanoate |
| SMILES | CCOC(=O)C(C)(CCCOCC1CCCC1)NC(C)C |
| InChI | InChI=1S/C17H33NO3/c1-5-21-16(19)17(4,18-14(2)3)11-8-12-20-13-15-9-6-7-10-15/h14-15,18H,5-13H2,1-4H3 |
| InChIKey | DLDJMVDGWMEOTR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|