C14H26F3NO3 — CID 66274410
ethyl 2-methyl-2-(propan-2-ylamino)-5-(1,1,1-trifluoropropan-2-yloxy)pentanoate (PubChem CID 66274410) has the molecular formula C14H26F3NO3 and a molecular weight of 313.36 g/mol. Its IUPAC name is ethyl 2-methyl-2-(propan-2-ylamino)-5-(1,1,1-trifluoropropan-2-yloxy)pentanoate.
| Compound Name | ethyl 2-methyl-2-(propan-2-ylamino)-5-(1,1,1-trifluoropropan-2-yloxy)pentanoate |
|---|---|
| PubChem CID | 66274410 |
| Molecular Formula | C14H26F3NO3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | ethyl 2-methyl-2-(propan-2-ylamino)-5-(1,1,1-trifluoropropan-2-yloxy)pentanoate |
| SMILES | CCOC(=O)C(C)(CCCOC(C)C(F)(F)F)NC(C)C |
| InChI | InChI=1S/C14H26F3NO3/c1-6-20-12(19)13(5,18-10(2)3)8-7-9-21-11(4)14(15,16)17/h10-11,18H,6-9H2,1-5H3 |
| InChIKey | SHNWYMFPDJBEBQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|