C13H25F3N2O2 — CID 66275068
2-methyl-2-(propylamino)-6-(1,1,1-trifluoropropan-2-yloxy)hexanamide (PubChem CID 66275068) has the molecular formula C13H25F3N2O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-methyl-2-(propylamino)-6-(1,1,1-trifluoropropan-2-yloxy)hexanamide.
| Compound Name | 2-methyl-2-(propylamino)-6-(1,1,1-trifluoropropan-2-yloxy)hexanamide |
|---|---|
| PubChem CID | 66275068 |
| Molecular Formula | C13H25F3N2O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-methyl-2-(propylamino)-6-(1,1,1-trifluoropropan-2-yloxy)hexanamide |
| SMILES | CCCNC(C)(CCCCOC(C)C(F)(F)F)C(N)=O |
| InChI | InChI=1S/C13H25F3N2O2/c1-4-8-18-12(3,11(17)19)7-5-6-9-20-10(2)13(14,15)16/h10,18H,4-9H2,1-3H3,(H2,17,19) |
| InChIKey | RHGOYFOTEXLRSM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|