C9H17F3N2O2 — CID 66274633
2-amino-2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pentanamide (PubChem CID 66274633) has the molecular formula C9H17F3N2O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 2-amino-2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pentanamide.
| Compound Name | 2-amino-2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pentanamide |
|---|---|
| PubChem CID | 66274633 |
| Molecular Formula | C9H17F3N2O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-amino-2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pentanamide |
| SMILES | CC(OCCCC(C)(N)C(N)=O)C(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O2/c1-6(9(10,11)12)16-5-3-4-8(2,14)7(13)15/h6H,3-5,14H2,1-2H3,(H2,13,15) |
| InChIKey | SZIHWJBMUDVDLD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|