C10H20F3NO2 — CID 66278597
1-amino-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)hexan-2-ol (PubChem CID 66278597) has the molecular formula C10H20F3NO2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 1-amino-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)hexan-2-ol.
| Compound Name | 1-amino-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)hexan-2-ol |
|---|---|
| PubChem CID | 66278597 |
| Molecular Formula | C10H20F3NO2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1-amino-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)hexan-2-ol |
| SMILES | CC(OCCCCC(C)(O)CN)C(F)(F)F |
| InChI | InChI=1S/C10H20F3NO2/c1-8(10(11,12)13)16-6-4-3-5-9(2,15)7-14/h8,15H,3-7,14H2,1-2H3 |
| InChIKey | JTTMXNZXIBNWSW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|