C11H22F3NO2 — CID 66275331
2-methyl-2-(methylamino)-6-(1,1,1-trifluoropropan-2-yloxy)hexan-1-ol (PubChem CID 66275331) has the molecular formula C11H22F3NO2 and a molecular weight of 257.30 g/mol. Its IUPAC name is 2-methyl-2-(methylamino)-6-(1,1,1-trifluoropropan-2-yloxy)hexan-1-ol.
| Compound Name | 2-methyl-2-(methylamino)-6-(1,1,1-trifluoropropan-2-yloxy)hexan-1-ol |
|---|---|
| PubChem CID | 66275331 |
| Molecular Formula | C11H22F3NO2 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-methyl-2-(methylamino)-6-(1,1,1-trifluoropropan-2-yloxy)hexan-1-ol |
| SMILES | CNC(C)(CO)CCCCOC(C)C(F)(F)F |
| InChI | InChI=1S/C11H22F3NO2/c1-9(11(12,13)14)17-7-5-4-6-10(2,8-16)15-3/h9,15-16H,4-8H2,1-3H3 |
| InChIKey | FLAOZEMXXKASRC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|