C10H20F3NO2 — CID 106811572
3-(aminomethyl)-6-(1,1,1-trifluoropropan-2-yloxy)hexan-3-ol (PubChem CID 106811572) has the molecular formula C10H20F3NO2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 3-(aminomethyl)-6-(1,1,1-trifluoropropan-2-yloxy)hexan-3-ol.
| Compound Name | 3-(aminomethyl)-6-(1,1,1-trifluoropropan-2-yloxy)hexan-3-ol |
|---|---|
| PubChem CID | 106811572 |
| Molecular Formula | C10H20F3NO2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3-(aminomethyl)-6-(1,1,1-trifluoropropan-2-yloxy)hexan-3-ol |
| SMILES | CCC(O)(CN)CCCOC(C)C(F)(F)F |
| InChI | InChI=1S/C10H20F3NO2/c1-3-9(15,7-14)5-4-6-16-8(2)10(11,12)13/h8,15H,3-7,14H2,1-2H3 |
| InChIKey | MRVIFLJXTTUESG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|