C12H22F3NO3 — CID 66275923
methyl 2-(ethylamino)-2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pentanoate (PubChem CID 66275923) has the molecular formula C12H22F3NO3 and a molecular weight of 285.31 g/mol. Its IUPAC name is methyl 2-(ethylamino)-2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pentanoate.
| Compound Name | methyl 2-(ethylamino)-2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pentanoate |
|---|---|
| PubChem CID | 66275923 |
| Molecular Formula | C12H22F3NO3 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | methyl 2-(ethylamino)-2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pentanoate |
| SMILES | CCNC(C)(CCCOC(C)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C12H22F3NO3/c1-5-16-11(3,10(17)18-4)7-6-8-19-9(2)12(13,14)15/h9,16H,5-8H2,1-4H3 |
| InChIKey | IJIQJIHEUWIDOD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|