C14H26F3NO3 — CID 82783283
methyl 2-(ethylamino)-2-methyl-6-(4,4,4-trifluorobutoxy)hexanoate (PubChem CID 82783283) has the molecular formula C14H26F3NO3 and a molecular weight of 313.36 g/mol. Its IUPAC name is methyl 2-(ethylamino)-2-methyl-6-(4,4,4-trifluorobutoxy)hexanoate.
| Compound Name | methyl 2-(ethylamino)-2-methyl-6-(4,4,4-trifluorobutoxy)hexanoate |
|---|---|
| PubChem CID | 82783283 |
| Molecular Formula | C14H26F3NO3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | methyl 2-(ethylamino)-2-methyl-6-(4,4,4-trifluorobutoxy)hexanoate |
| SMILES | CCNC(C)(CCCCOCCCC(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C14H26F3NO3/c1-4-18-13(2,12(19)20-3)8-5-6-10-21-11-7-9-14(15,16)17/h18H,4-11H2,1-3H3 |
| InChIKey | HYOYAIMLDWZYBT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|