C14H26F3NO3 — CID 82783635
2-methyl-2-(propylamino)-6-(4,4,4-trifluorobutoxy)hexanoic acid (PubChem CID 82783635) has the molecular formula C14H26F3NO3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-methyl-2-(propylamino)-6-(4,4,4-trifluorobutoxy)hexanoic acid.
| Compound Name | 2-methyl-2-(propylamino)-6-(4,4,4-trifluorobutoxy)hexanoic acid |
|---|---|
| PubChem CID | 82783635 |
| Molecular Formula | C14H26F3NO3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 2-methyl-2-(propylamino)-6-(4,4,4-trifluorobutoxy)hexanoic acid |
| SMILES | CCCNC(C)(CCCCOCCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C14H26F3NO3/c1-3-9-18-13(2,12(19)20)7-4-5-10-21-11-6-8-14(15,16)17/h18H,3-11H2,1-2H3,(H,19,20) |
| InChIKey | NFMRFBFJJQHBRZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|