C13H24F3NO3 — CID 82957801
methyl 2-methyl-2-(propylamino)-5-(3,3,3-trifluoropropoxy)pentanoate (PubChem CID 82957801) has the molecular formula C13H24F3NO3 and a molecular weight of 299.33 g/mol. Its IUPAC name is methyl 2-methyl-2-(propylamino)-5-(3,3,3-trifluoropropoxy)pentanoate.
| Compound Name | methyl 2-methyl-2-(propylamino)-5-(3,3,3-trifluoropropoxy)pentanoate |
|---|---|
| PubChem CID | 82957801 |
| Molecular Formula | C13H24F3NO3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | methyl 2-methyl-2-(propylamino)-5-(3,3,3-trifluoropropoxy)pentanoate |
| SMILES | CCCNC(C)(CCCOCCC(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C13H24F3NO3/c1-4-8-17-12(2,11(18)19-3)6-5-9-20-10-7-13(14,15)16/h17H,4-10H2,1-3H3 |
| InChIKey | RHMIBONYRLJZQF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|