About methyl 4-methoxy-2,4-dimethyl-2-(propylamino)pentanoate
methyl 4-methoxy-2,4-dimethyl-2-(propylamino)pentanoate (PubChem CID 60796248) has the molecular formula C12H25NO3
and a molecular weight of 231.34 g/mol. Its IUPAC name is methyl 4-methoxy-2,4-dimethyl-2-(propylamino)pentanoate.
Analyze methyl 4-methoxy-2,4-dimethyl-2-(propylamino)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methoxy-2,4-dimethyl-2-(propylamino)pentanoate?
The IUPAC name of methyl 4-methoxy-2,4-dimethyl-2-(propylamino)pentanoate (CID 60796248) is methyl 4-methoxy-2,4-dimethyl-2-(propylamino)pentanoate.
What is the SMILES notation for methyl 4-methoxy-2,4-dimethyl-2-(propylamino)pentanoate?
The canonical SMILES for methyl 4-methoxy-2,4-dimethyl-2-(propylamino)pentanoate is CCCNC(C)(CC(C)(C)OC)C(=O)OC.
What is the InChIKey of methyl 4-methoxy-2,4-dimethyl-2-(propylamino)pentanoate?
The InChIKey is YMWLMLZJSQUNPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO3/c1-7-8-13-12(4,10(14)15-5)9-11(2,3)16-6/h13H,7-9H2,1-6H3.
What are the key properties of methyl 4-methoxy-2,4-dimethyl-2-(propylamino)pentanoate?
methyl 4-methoxy-2,4-dimethyl-2-(propylamino)pentanoate has a molecular weight of 231.34 g/mol, XLogP of 1.73, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methoxy-2,4-dimethyl-2-(propylamino)pentanoate is sourced from PubChem (CID 60796248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).