About methyl 2-(cyclopropylmethylamino)-4-methoxy-2,4-dimethylpentanoate
methyl 2-(cyclopropylmethylamino)-4-methoxy-2,4-dimethylpentanoate (PubChem CID 54894120) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is methyl 2-(cyclopropylmethylamino)-4-methoxy-2,4-dimethylpentanoate.
Molecular Properties
| Compound Name | methyl 2-(cyclopropylmethylamino)-4-methoxy-2,4-dimethylpentanoate |
| PubChem CID | 54894120 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | methyl 2-(cyclopropylmethylamino)-4-methoxy-2,4-dimethylpentanoate |
| SMILES | COC(=O)C(C)(CC(C)(C)OC)NCC1CC1 |
| InChI | InChI=1S/C13H25NO3/c1-12(2,17-5)9-13(3,11(15)16-4)14-8-10-6-7-10/h10,14H,6-9H2,1-5H3 |
| InChIKey | HPKVENIHLJQWKR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(cyclopropylmethylamino)-4-methoxy-2,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(cyclopropylmethylamino)-4-methoxy-2,4-dimethylpentanoate?
The IUPAC name of methyl 2-(cyclopropylmethylamino)-4-methoxy-2,4-dimethylpentanoate (CID 54894120) is methyl 2-(cyclopropylmethylamino)-4-methoxy-2,4-dimethylpentanoate.
What is the SMILES notation for methyl 2-(cyclopropylmethylamino)-4-methoxy-2,4-dimethylpentanoate?
The canonical SMILES for methyl 2-(cyclopropylmethylamino)-4-methoxy-2,4-dimethylpentanoate is COC(=O)C(C)(CC(C)(C)OC)NCC1CC1.
What is the InChIKey of methyl 2-(cyclopropylmethylamino)-4-methoxy-2,4-dimethylpentanoate?
The InChIKey is HPKVENIHLJQWKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3/c1-12(2,17-5)9-13(3,11(15)16-4)14-8-10-6-7-10/h10,14H,6-9H2,1-5H3.
What are the key properties of methyl 2-(cyclopropylmethylamino)-4-methoxy-2,4-dimethylpentanoate?
methyl 2-(cyclopropylmethylamino)-4-methoxy-2,4-dimethylpentanoate has a molecular weight of 243.35 g/mol, XLogP of 1.73, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(cyclopropylmethylamino)-4-methoxy-2,4-dimethylpentanoate is sourced from PubChem (CID 54894120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).