C9H16F3NO3 — CID 82956754
methyl 2-amino-2-methyl-4-(3,3,3-trifluoropropoxy)butanoate (PubChem CID 82956754) has the molecular formula C9H16F3NO3 and a molecular weight of 243.22 g/mol. Its IUPAC name is methyl 2-amino-2-methyl-4-(3,3,3-trifluoropropoxy)butanoate.
| Compound Name | methyl 2-amino-2-methyl-4-(3,3,3-trifluoropropoxy)butanoate |
|---|---|
| PubChem CID | 82956754 |
| Molecular Formula | C9H16F3NO3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | methyl 2-amino-2-methyl-4-(3,3,3-trifluoropropoxy)butanoate |
| SMILES | COC(=O)C(C)(N)CCOCCC(F)(F)F |
| InChI | InChI=1S/C9H16F3NO3/c1-8(13,7(14)15-2)3-5-16-6-4-9(10,11)12/h3-6,13H2,1-2H3 |
| InChIKey | WUMBJTQNKOVGDL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|