C10H18F3NO3 — CID 82792259
2-amino-2-methyl-5-(4,4,4-trifluorobutoxy)pentanoic acid (PubChem CID 82792259) has the molecular formula C10H18F3NO3 and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-amino-2-methyl-5-(4,4,4-trifluorobutoxy)pentanoic acid.
| Compound Name | 2-amino-2-methyl-5-(4,4,4-trifluorobutoxy)pentanoic acid |
|---|---|
| PubChem CID | 82792259 |
| Molecular Formula | C10H18F3NO3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-amino-2-methyl-5-(4,4,4-trifluorobutoxy)pentanoic acid |
| SMILES | CC(N)(CCCOCCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H18F3NO3/c1-9(14,8(15)16)4-2-6-17-7-3-5-10(11,12)13/h2-7,14H2,1H3,(H,15,16) |
| InChIKey | RIXKVVSCNCEDMZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|