C10H20N2O4 — CID 18936054
2,7-diamino-2,7-dimethyloctanedioic acid (PubChem CID 18936054) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2,7-diamino-2,7-dimethyloctanedioic acid.
| Compound Name | 2,7-diamino-2,7-dimethyloctanedioic acid |
|---|---|
| PubChem CID | 18936054 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2,7-diamino-2,7-dimethyloctanedioic acid |
| SMILES | CC(N)(CCCCC(C)(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H20N2O4/c1-9(11,7(13)14)5-3-4-6-10(2,12)8(15)16/h3-6,11-12H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | HOYDXHYCTPRHEO-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|