2,8-diamino-2-methyloctanoic acid

C9H20N2O2 — CID 87814639

IUPAC2,8-diamino-2-methyloctanoic acid
SMILESCC(N)(CCCCCCN)C(=O)O
InChIInChI=1S/C9H20N2O2/c1-9(11,8(12)13)6-4-2-3-5-7-10/h2-7,10-11H2,1H3,(H,12,13)
InChIKeyZSOMLUKLVIXWFO-UHFFFAOYSA-N
MW188.27 g/mol
LogP0.70
Rot. Bonds7

About 2,8-diamino-2-methyloctanoic acid

2,8-diamino-2-methyloctanoic acid (PubChem CID 87814639) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2,8-diamino-2-methyloctanoic acid.

Molecular Properties

Compound Name2,8-diamino-2-methyloctanoic acid
PubChem CID87814639
Molecular FormulaC9H20N2O2
Molecular Weight188.27 g/mol
Exact Mass188.15
IUPAC Name2,8-diamino-2-methyloctanoic acid
SMILESCC(N)(CCCCCCN)C(=O)O
InChIInChI=1S/C9H20N2O2/c1-9(11,8(12)13)6-4-2-3-5-7-10/h2-7,10-11H2,1H3,(H,12,13)
InChIKeyZSOMLUKLVIXWFO-UHFFFAOYSA-N
XLogP0.70
TPSA89.34 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.27
LogP ≤ 50.70
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2,8-diamino-2-methyloctanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2,6-diamino-2-methylhexanoic acid
CID 3017540
2,7-diamino-2,7-dimethyloctanedioic acid
CID 18936054
2-amino-6-hydroxy-2-methylhexanoic acid
CID 22000473
(2S)-2,5-diamino-2-(deuteriomethyl)pentanoic acid
CID 57018880
2-amino-2-methyldec-9-enoic acid
CID 76833646
(2S)-2-amino-6-borono-2-methylhexanoic acid
CID 53249972
(2S)-2-amino-2-methyldec-8-ynoic acid
CID 137350215
2,5-diamino-2-methylpentanamide
CID 130907221
2-amino-2-(4-aminobutyl)icosanoic acid;dihydrochloride
CID 20978392
(2R)-2-acetyl-2,6-diaminohexanoic acid
CID 22853479
(2S)-2,6-diamino-2-(dimethylamino)hexanoic acid
CID 151285535
(2S)-2-amino-2-methyldec-9-enoic acid;(2R)-2-amino-2-methyldec-9-enoic acid;(2S)-2-amino-2-methylhept-6-enoic acid;(2R)-2-amino-2-methylhept-6-enoic acid;2-amino-2-pent-4-enylhept-6-enoic acid;methane
CID 167617525

Frequently Asked Questions

What is the IUPAC name of 2,8-diamino-2-methyloctanoic acid?
The IUPAC name of 2,8-diamino-2-methyloctanoic acid (CID 87814639) is 2,8-diamino-2-methyloctanoic acid.
What is the SMILES notation for 2,8-diamino-2-methyloctanoic acid?
The canonical SMILES for 2,8-diamino-2-methyloctanoic acid is CC(N)(CCCCCCN)C(=O)O.
What is the InChIKey of 2,8-diamino-2-methyloctanoic acid?
The InChIKey is ZSOMLUKLVIXWFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O2/c1-9(11,8(12)13)6-4-2-3-5-7-10/h2-7,10-11H2,1H3,(H,12,13).
What are the key properties of 2,8-diamino-2-methyloctanoic acid?
2,8-diamino-2-methyloctanoic acid has a molecular weight of 188.27 g/mol, XLogP of 0.70, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-diamino-2-methyloctanoic acid is sourced from PubChem (CID 87814639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).