C9H15F3O3 — CID 82788319
2,2-dimethyl-3-(4,4,4-trifluorobutoxy)propanoic acid (PubChem CID 82788319) has the molecular formula C9H15F3O3 and a molecular weight of 228.21 g/mol. Its IUPAC name is 2,2-dimethyl-3-(4,4,4-trifluorobutoxy)propanoic acid.
| Compound Name | 2,2-dimethyl-3-(4,4,4-trifluorobutoxy)propanoic acid |
|---|---|
| PubChem CID | 82788319 |
| Molecular Formula | C9H15F3O3 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2,2-dimethyl-3-(4,4,4-trifluorobutoxy)propanoic acid |
| SMILES | CC(C)(COCCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H15F3O3/c1-8(2,7(13)14)6-15-5-3-4-9(10,11)12/h3-6H2,1-2H3,(H,13,14) |
| InChIKey | CYQKDDHVKKHBFK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|