C14H25F3O3 — CID 123273899
[2,3-dimethyl-6-(4,4,4-trifluorobutoxy)hexan-3-yl] acetate (PubChem CID 123273899) has the molecular formula C14H25F3O3 and a molecular weight of 298.35 g/mol. Its IUPAC name is [2,3-dimethyl-6-(4,4,4-trifluorobutoxy)hexan-3-yl] acetate.
| Compound Name | [2,3-dimethyl-6-(4,4,4-trifluorobutoxy)hexan-3-yl] acetate |
|---|---|
| PubChem CID | 123273899 |
| Molecular Formula | C14H25F3O3 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [2,3-dimethyl-6-(4,4,4-trifluorobutoxy)hexan-3-yl] acetate |
| SMILES | CC(=O)OC(C)(CCCOCCCC(F)(F)F)C(C)C |
| InChI | InChI=1S/C14H25F3O3/c1-11(2)13(4,20-12(3)18)7-5-9-19-10-6-8-14(15,16)17/h11H,5-10H2,1-4H3 |
| InChIKey | PSMSANWAAGOYGB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|