C11H20F3NO3 — CID 82793311
2-methyl-2-(methylamino)-5-(4,4,4-trifluorobutoxy)pentanoic acid (PubChem CID 82793311) has the molecular formula C11H20F3NO3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-methyl-2-(methylamino)-5-(4,4,4-trifluorobutoxy)pentanoic acid.
| Compound Name | 2-methyl-2-(methylamino)-5-(4,4,4-trifluorobutoxy)pentanoic acid |
|---|---|
| PubChem CID | 82793311 |
| Molecular Formula | C11H20F3NO3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-methyl-2-(methylamino)-5-(4,4,4-trifluorobutoxy)pentanoic acid |
| SMILES | CNC(C)(CCCOCCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H20F3NO3/c1-10(15-2,9(16)17)5-3-7-18-8-4-6-11(12,13)14/h15H,3-8H2,1-2H3,(H,16,17) |
| InChIKey | VQDQCVYWYAFEIT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|