C12H20F5NO3 — CID 103725386
2-methyl-5-(2,2,3,3,3-pentafluoropropoxy)-2-(propan-2-ylamino)pentanoic acid (PubChem CID 103725386) has the molecular formula C12H20F5NO3 and a molecular weight of 321.29 g/mol. Its IUPAC name is 2-methyl-5-(2,2,3,3,3-pentafluoropropoxy)-2-(propan-2-ylamino)pentanoic acid.
| Compound Name | 2-methyl-5-(2,2,3,3,3-pentafluoropropoxy)-2-(propan-2-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 103725386 |
| Molecular Formula | C12H20F5NO3 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 2-methyl-5-(2,2,3,3,3-pentafluoropropoxy)-2-(propan-2-ylamino)pentanoic acid |
| SMILES | CC(C)NC(C)(CCCOCC(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C12H20F5NO3/c1-8(2)18-10(3,9(19)20)5-4-6-21-7-11(13,14)12(15,16)17/h8,18H,4-7H2,1-3H3,(H,19,20) |
| InChIKey | MSLUZXNIKTXTEH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|