C15H21F2NO3 — CID 81265073
5-(2,6-difluorophenoxy)-2-methyl-2-(propan-2-ylamino)pentanoic acid (PubChem CID 81265073) has the molecular formula C15H21F2NO3 and a molecular weight of 301.33 g/mol. Its IUPAC name is 5-(2,6-difluorophenoxy)-2-methyl-2-(propan-2-ylamino)pentanoic acid.
| Compound Name | 5-(2,6-difluorophenoxy)-2-methyl-2-(propan-2-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 81265073 |
| Molecular Formula | C15H21F2NO3 |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 5-(2,6-difluorophenoxy)-2-methyl-2-(propan-2-ylamino)pentanoic acid |
| SMILES | CC(C)NC(C)(CCCOc1c(F)cccc1F)C(=O)O |
| InChI | InChI=1S/C15H21F2NO3/c1-10(2)18-15(3,14(19)20)8-5-9-21-13-11(16)6-4-7-12(13)17/h4,6-7,10,18H,5,8-9H2,1-3H3,(H,19,20) |
| InChIKey | WLYRWVMXUWUHEV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|